C18H14ClF3N2S — CID 21402206
1-[2-(4-chlorophenyl)sulfanyl-2-[2-(trifluoromethyl)phenyl]ethyl]imidazole (PubChem CID 21402206) has the molecular formula C18H14ClF3N2S and a molecular weight of 382.84 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanyl-2-[2-(trifluoromethyl)phenyl]ethyl]imidazole.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanyl-2-[2-(trifluoromethyl)phenyl]ethyl]imidazole |
|---|---|
| PubChem CID | 21402206 |
| Molecular Formula | C18H14ClF3N2S |
| Molecular Weight | 382.84 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanyl-2-[2-(trifluoromethyl)phenyl]ethyl]imidazole |
| SMILES | FC(F)(F)c1ccccc1C(Cn1ccnc1)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14ClF3N2S/c19-13-5-7-14(8-6-13)25-17(11-24-10-9-23-12-24)15-3-1-2-4-16(15)18(20,21)22/h1-10,12,17H,11H2 |
| InChIKey | BCUFOFDKMCBOSI-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.84 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |