C20H20ClN2NaO2S — CID 173353595
sodium;4-[4-(4-chlorophenyl)-1-imidazol-1-ylbutan-2-yl]sulfanylbenzoic acid;hydride (PubChem CID 173353595) has the molecular formula C20H20ClN2NaO2S and a molecular weight of 410.90 g/mol. Its IUPAC name is sodium;4-[4-(4-chlorophenyl)-1-imidazol-1-ylbutan-2-yl]sulfanylbenzoic acid;hydride.
| Compound Name | sodium;4-[4-(4-chlorophenyl)-1-imidazol-1-ylbutan-2-yl]sulfanylbenzoic acid;hydride |
|---|---|
| PubChem CID | 173353595 |
| Molecular Formula | C20H20ClN2NaO2S |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | sodium;4-[4-(4-chlorophenyl)-1-imidazol-1-ylbutan-2-yl]sulfanylbenzoic acid;hydride |
| SMILES | O=C(O)c1ccc(SC(CCc2ccc(Cl)cc2)Cn2ccnc2)cc1.[H-].[Na+] |
| InChI | InChI=1S/C20H19ClN2O2S.Na.H/c21-17-6-1-15(2-7-17)3-8-19(13-23-12-11-22-14-23)26-18-9-4-16(5-10-18)20(24)25;;/h1-2,4-7,9-12,14,19H,3,8,13H2,(H,24,25);;/q;+1;-1 |
| InChIKey | XHWHVYQKSWSOQH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |