C27H26ClN3O2 — CID 70473677
N-[4-[4-(4-chlorophenyl)-1-imidazol-1-ylbutan-2-yl]oxyphenyl]-N-methylbenzamide (PubChem CID 70473677) has the molecular formula C27H26ClN3O2 and a molecular weight of 459.98 g/mol. Its IUPAC name is N-[4-[4-(4-chlorophenyl)-1-imidazol-1-ylbutan-2-yl]oxyphenyl]-N-methylbenzamide.
| Compound Name | N-[4-[4-(4-chlorophenyl)-1-imidazol-1-ylbutan-2-yl]oxyphenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 70473677 |
| Molecular Formula | C27H26ClN3O2 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | N-[4-[4-(4-chlorophenyl)-1-imidazol-1-ylbutan-2-yl]oxyphenyl]-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccccc1)c1ccc(OC(CCc2ccc(Cl)cc2)Cn2ccnc2)cc1 |
| InChI | InChI=1S/C27H26ClN3O2/c1-30(27(32)22-5-3-2-4-6-22)24-12-15-25(16-13-24)33-26(19-31-18-17-29-20-31)14-9-21-7-10-23(28)11-8-21/h2-8,10-13,15-18,20,26H,9,14,19H2,1H3 |
| InChIKey | VHHAUVWJVMLRIC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |