C26H32ClN5OS — CID 54008561
4-[4-[4-(4-chlorophenyl)-1-imidazol-1-ylbutan-2-yl]oxyphenyl]-N,N-dimethylpiperazine-1-carbothioamide (PubChem CID 54008561) has the molecular formula C26H32ClN5OS and a molecular weight of 498.10 g/mol. Its IUPAC name is 4-[4-[4-(4-chlorophenyl)-1-imidazol-1-ylbutan-2-yl]oxyphenyl]-N,N-dimethylpiperazine-1-carbothioamide.
| Compound Name | 4-[4-[4-(4-chlorophenyl)-1-imidazol-1-ylbutan-2-yl]oxyphenyl]-N,N-dimethylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 54008561 |
| Molecular Formula | C26H32ClN5OS |
| Molecular Weight | 498.10 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 4-[4-[4-(4-chlorophenyl)-1-imidazol-1-ylbutan-2-yl]oxyphenyl]-N,N-dimethylpiperazine-1-carbothioamide |
| SMILES | CN(C)C(=S)N1CCN(c2ccc(OC(CCc3ccc(Cl)cc3)Cn3ccnc3)cc2)CC1 |
| InChI | InChI=1S/C26H32ClN5OS/c1-29(2)26(34)32-17-15-31(16-18-32)23-8-11-24(12-9-23)33-25(19-30-14-13-28-20-30)10-5-21-3-6-22(27)7-4-21/h3-4,6-9,11-14,20,25H,5,10,15-19H2,1-2H3 |
| InChIKey | KQQOTLPRFHZQFZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 36.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.10 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|