C24H28ClN5OS — CID 54317488
4-[4-[4-(4-chlorophenyl)-1-imidazol-1-ylbutan-2-yl]oxyphenyl]piperazine-1-carbothioamide (PubChem CID 54317488) has the molecular formula C24H28ClN5OS and a molecular weight of 470.04 g/mol. Its IUPAC name is 4-[4-[4-(4-chlorophenyl)-1-imidazol-1-ylbutan-2-yl]oxyphenyl]piperazine-1-carbothioamide.
| Compound Name | 4-[4-[4-(4-chlorophenyl)-1-imidazol-1-ylbutan-2-yl]oxyphenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 54317488 |
| Molecular Formula | C24H28ClN5OS |
| Molecular Weight | 470.04 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 4-[4-[4-(4-chlorophenyl)-1-imidazol-1-ylbutan-2-yl]oxyphenyl]piperazine-1-carbothioamide |
| SMILES | NC(=S)N1CCN(c2ccc(OC(CCc3ccc(Cl)cc3)Cn3ccnc3)cc2)CC1 |
| InChI | InChI=1S/C24H28ClN5OS/c25-20-4-1-19(2-5-20)3-8-23(17-28-12-11-27-18-28)31-22-9-6-21(7-10-22)29-13-15-30(16-14-29)24(26)32/h1-2,4-7,9-12,18,23H,3,8,13-17H2,(H2,26,32) |
| InChIKey | SPGFEOFVTSGUPN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 59.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.04 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|