C27H30Cl2N4O4 — CID 139229719
1-[4-[4-[[2-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone (PubChem CID 139229719) has the molecular formula C27H30Cl2N4O4 and a molecular weight of 545.47 g/mol. Its IUPAC name is 1-[4-[4-[[2-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[4-[[2-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 139229719 |
| Molecular Formula | C27H30Cl2N4O4 |
| Molecular Weight | 545.47 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | 1-[4-[4-[[2-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc(OCC3COC(C(Cn4ccnc4)c4ccc(Cl)cc4Cl)O3)cc2)CC1 |
| InChI | InChI=1S/C27H30Cl2N4O4/c1-19(34)32-10-12-33(13-11-32)21-3-5-22(6-4-21)35-16-23-17-36-27(37-23)25(15-31-9-8-30-18-31)24-7-2-20(28)14-26(24)29/h2-9,14,18,23,25,27H,10-13,15-17H2,1H3 |
| InChIKey | FLIWGRQQBXHDOD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 69.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|