C19H17Cl4N3O3S — CID 172777535
1-[4-(4-chlorophenyl)-2-(2,4,6-trichlorophenyl)sulfanylbutyl]imidazole;nitric acid (PubChem CID 172777535) has the molecular formula C19H17Cl4N3O3S and a molecular weight of 509.24 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)-2-(2,4,6-trichlorophenyl)sulfanylbutyl]imidazole;nitric acid.
| Compound Name | 1-[4-(4-chlorophenyl)-2-(2,4,6-trichlorophenyl)sulfanylbutyl]imidazole;nitric acid |
|---|---|
| PubChem CID | 172777535 |
| Molecular Formula | C19H17Cl4N3O3S |
| Molecular Weight | 509.24 g/mol |
| Exact Mass | 506.97 |
| IUPAC Name | 1-[4-(4-chlorophenyl)-2-(2,4,6-trichlorophenyl)sulfanylbutyl]imidazole;nitric acid |
| SMILES | Clc1ccc(CCC(Cn2ccnc2)Sc2c(Cl)cc(Cl)cc2Cl)cc1.O=[N+]([O-])O |
| InChI | InChI=1S/C19H16Cl4N2S.HNO3/c20-14-4-1-13(2-5-14)3-6-16(11-25-8-7-24-12-25)26-19-17(22)9-15(21)10-18(19)23;2-1(3)4/h1-2,4-5,7-10,12,16H,3,6,11H2;(H,2,3,4) |
| InChIKey | NUPGSBWOMTZBND-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.24 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|