C19H16Cl4N2S — CID 162180732
1-[4-(4-chlorophenyl)-2-(2,3,6-trichlorophenyl)sulfanylbutyl]imidazole (PubChem CID 162180732) has the molecular formula C19H16Cl4N2S and a molecular weight of 446.23 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)-2-(2,3,6-trichlorophenyl)sulfanylbutyl]imidazole.
| Compound Name | 1-[4-(4-chlorophenyl)-2-(2,3,6-trichlorophenyl)sulfanylbutyl]imidazole |
|---|---|
| PubChem CID | 162180732 |
| Molecular Formula | C19H16Cl4N2S |
| Molecular Weight | 446.23 g/mol |
| Exact Mass | 443.98 |
| IUPAC Name | 1-[4-(4-chlorophenyl)-2-(2,3,6-trichlorophenyl)sulfanylbutyl]imidazole |
| SMILES | Clc1ccc(CCC(Cn2ccnc2)Sc2c(Cl)ccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C19H16Cl4N2S/c20-14-4-1-13(2-5-14)3-6-15(11-25-10-9-24-12-25)26-19-17(22)8-7-16(21)18(19)23/h1-2,4-5,7-10,12,15H,3,6,11H2 |
| InChIKey | ZOZCKXYSDKPTJG-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.23 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|