C19H19Cl3N2S2 — CID 13320313
1-[2,2-bis[(4-chlorophenyl)methylsulfanyl]ethyl]imidazole;hydrochloride (PubChem CID 13320313) has the molecular formula C19H19Cl3N2S2 and a molecular weight of 445.87 g/mol. Its IUPAC name is 1-[2,2-bis[(4-chlorophenyl)methylsulfanyl]ethyl]imidazole;hydrochloride.
| Compound Name | 1-[2,2-bis[(4-chlorophenyl)methylsulfanyl]ethyl]imidazole;hydrochloride |
|---|---|
| PubChem CID | 13320313 |
| Molecular Formula | C19H19Cl3N2S2 |
| Molecular Weight | 445.87 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | 1-[2,2-bis[(4-chlorophenyl)methylsulfanyl]ethyl]imidazole;hydrochloride |
| SMILES | Cl.Clc1ccc(CSC(Cn2ccnc2)SCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H18Cl2N2S2.ClH/c20-17-5-1-15(2-6-17)12-24-19(11-23-10-9-22-14-23)25-13-16-3-7-18(21)8-4-16;/h1-10,14,19H,11-13H2;1H |
| InChIKey | GNWHDUDZWRHFAJ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.87 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|