C18H26N2S2 — CID 21423798
1-[2-[(4-tert-butylphenyl)methylsulfanyl]-3-methylsulfanylpropyl]imidazole (PubChem CID 21423798) has the molecular formula C18H26N2S2 and a molecular weight of 334.55 g/mol. Its IUPAC name is 1-[2-[(4-tert-butylphenyl)methylsulfanyl]-3-methylsulfanylpropyl]imidazole.
| Compound Name | 1-[2-[(4-tert-butylphenyl)methylsulfanyl]-3-methylsulfanylpropyl]imidazole |
|---|---|
| PubChem CID | 21423798 |
| Molecular Formula | C18H26N2S2 |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-[2-[(4-tert-butylphenyl)methylsulfanyl]-3-methylsulfanylpropyl]imidazole |
| SMILES | CSCC(Cn1ccnc1)SCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H26N2S2/c1-18(2,3)16-7-5-15(6-8-16)12-22-17(13-21-4)11-20-10-9-19-14-20/h5-10,14,17H,11-13H2,1-4H3 |
| InChIKey | AIUWHCJTZRDSAX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |