C23H27FN2O — CID 170562612
1-[2-(4-tert-butylphenyl)-4-(4-fluorophenoxy)butyl]imidazole (PubChem CID 170562612) has the molecular formula C23H27FN2O and a molecular weight of 366.48 g/mol. Its IUPAC name is 1-[2-(4-tert-butylphenyl)-4-(4-fluorophenoxy)butyl]imidazole.
| Compound Name | 1-[2-(4-tert-butylphenyl)-4-(4-fluorophenoxy)butyl]imidazole |
|---|---|
| PubChem CID | 170562612 |
| Molecular Formula | C23H27FN2O |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 1-[2-(4-tert-butylphenyl)-4-(4-fluorophenoxy)butyl]imidazole |
| SMILES | CC(C)(C)c1ccc(C(CCOc2ccc(F)cc2)Cn2ccnc2)cc1 |
| InChI | InChI=1S/C23H27FN2O/c1-23(2,3)20-6-4-18(5-7-20)19(16-26-14-13-25-17-26)12-15-27-22-10-8-21(24)9-11-22/h4-11,13-14,17,19H,12,15-16H2,1-3H3 |
| InChIKey | OJQAFIIVZTXPIE-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |