C19H29FN3O3+ — CID 6333710
dihydroxy(oxo)azanium;1-[2-(4-fluorophenyl)decyl]imidazole (PubChem CID 6333710) has the molecular formula C19H29FN3O3+ and a molecular weight of 366.46 g/mol. Its IUPAC name is dihydroxy(oxo)azanium;1-[2-(4-fluorophenyl)decyl]imidazole.
| Compound Name | dihydroxy(oxo)azanium;1-[2-(4-fluorophenyl)decyl]imidazole |
|---|---|
| PubChem CID | 6333710 |
| Molecular Formula | C19H29FN3O3+ |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | dihydroxy(oxo)azanium;1-[2-(4-fluorophenyl)decyl]imidazole |
| SMILES | CCCCCCCCC(Cn1ccnc1)c1ccc(F)cc1.O=[N+](O)O |
| InChI | InChI=1S/C19H27FN2.H2NO3/c1-2-3-4-5-6-7-8-18(15-22-14-13-21-16-22)17-9-11-19(20)12-10-17;2-1(3)4/h9-14,16,18H,2-8,15H2,1H3;(H2,2,3,4)/q;+1 |
| InChIKey | JTMRFSARFVOWCS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 78.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|