C21H27ClN2O4 — CID 5477098
(E)-but-2-enedioic acid;1-[2-(2-chlorophenyl)octyl]imidazole (PubChem CID 5477098) has the molecular formula C21H27ClN2O4 and a molecular weight of 406.91 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-[2-(2-chlorophenyl)octyl]imidazole.
| Compound Name | (E)-but-2-enedioic acid;1-[2-(2-chlorophenyl)octyl]imidazole |
|---|---|
| PubChem CID | 5477098 |
| Molecular Formula | C21H27ClN2O4 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (E)-but-2-enedioic acid;1-[2-(2-chlorophenyl)octyl]imidazole |
| SMILES | CCCCCCC(Cn1ccnc1)c1ccccc1Cl.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H23ClN2.C4H4O4/c1-2-3-4-5-8-15(13-20-12-11-19-14-20)16-9-6-7-10-17(16)18;5-3(6)1-2-4(7)8/h6-7,9-12,14-15H,2-5,8,13H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | ZYHQPJVGUFYRGW-WLHGVMLRSA-N |
| XLogP | 5.00 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|