C21H26Cl2N2O5S — CID 90672791
S-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl] octanethioate;oxalic acid (PubChem CID 90672791) has the molecular formula C21H26Cl2N2O5S and a molecular weight of 489.42 g/mol. Its IUPAC name is S-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl] octanethioate;oxalic acid.
| Compound Name | S-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl] octanethioate;oxalic acid |
|---|---|
| PubChem CID | 90672791 |
| Molecular Formula | C21H26Cl2N2O5S |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | S-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl] octanethioate;oxalic acid |
| SMILES | CCCCCCCC(=O)SC(Cn1ccnc1)c1ccc(Cl)cc1Cl.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H24Cl2N2OS.C2H2O4/c1-2-3-4-5-6-7-19(24)25-18(13-23-11-10-22-14-23)16-9-8-15(20)12-17(16)21;3-1(4)2(5)6/h8-12,14,18H,2-7,13H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | XMFNMLCSTNAIQD-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|