C17H22Cl2N2S — CID 21415372
1-[3-(2,4-dichlorophenyl)-3-pentylsulfanylpropyl]imidazole (PubChem CID 21415372) has the molecular formula C17H22Cl2N2S and a molecular weight of 357.35 g/mol. Its IUPAC name is 1-[3-(2,4-dichlorophenyl)-3-pentylsulfanylpropyl]imidazole.
| Compound Name | 1-[3-(2,4-dichlorophenyl)-3-pentylsulfanylpropyl]imidazole |
|---|---|
| PubChem CID | 21415372 |
| Molecular Formula | C17H22Cl2N2S |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 1-[3-(2,4-dichlorophenyl)-3-pentylsulfanylpropyl]imidazole |
| SMILES | CCCCCSC(CCn1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H22Cl2N2S/c1-2-3-4-11-22-17(7-9-21-10-8-20-13-21)15-6-5-14(18)12-16(15)19/h5-6,8,10,12-13,17H,2-4,7,9,11H2,1H3 |
| InChIKey | CKSJKHWVOXNWNB-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|