C19H26Cl2N2S — CID 21415321
1-[3-[(2,4-dichlorophenyl)methylsulfanyl]nonyl]imidazole (PubChem CID 21415321) has the molecular formula C19H26Cl2N2S and a molecular weight of 385.40 g/mol. Its IUPAC name is 1-[3-[(2,4-dichlorophenyl)methylsulfanyl]nonyl]imidazole.
| Compound Name | 1-[3-[(2,4-dichlorophenyl)methylsulfanyl]nonyl]imidazole |
|---|---|
| PubChem CID | 21415321 |
| Molecular Formula | C19H26Cl2N2S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 1-[3-[(2,4-dichlorophenyl)methylsulfanyl]nonyl]imidazole |
| SMILES | CCCCCCC(CCn1ccnc1)SCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H26Cl2N2S/c1-2-3-4-5-6-18(9-11-23-12-10-22-15-23)24-14-16-7-8-17(20)13-19(16)21/h7-8,10,12-13,15,18H,2-6,9,11,14H2,1H3 |
| InChIKey | ACQCVMFATDJWHO-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|