C22H24Cl2N2OS — CID 21402393
1-[2-(4-butoxyphenyl)-2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]imidazole (PubChem CID 21402393) has the molecular formula C22H24Cl2N2OS and a molecular weight of 435.42 g/mol. Its IUPAC name is 1-[2-(4-butoxyphenyl)-2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]imidazole.
| Compound Name | 1-[2-(4-butoxyphenyl)-2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]imidazole |
|---|---|
| PubChem CID | 21402393 |
| Molecular Formula | C22H24Cl2N2OS |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 1-[2-(4-butoxyphenyl)-2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]imidazole |
| SMILES | CCCCOc1ccc(C(Cn2ccnc2)SCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C22H24Cl2N2OS/c1-2-3-12-27-20-8-5-17(6-9-20)22(14-26-11-10-25-16-26)28-15-18-4-7-19(23)13-21(18)24/h4-11,13,16,22H,2-3,12,14-15H2,1H3 |
| InChIKey | GVMYAOKKWQSBHY-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|