C13H14Cl2N2OS — CID 20572789
1-[(2,4-dichlorophenyl)methylsulfanyl]-3-imidazol-1-ylpropan-1-ol (PubChem CID 20572789) has the molecular formula C13H14Cl2N2OS and a molecular weight of 317.24 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methylsulfanyl]-3-imidazol-1-ylpropan-1-ol.
| Compound Name | 1-[(2,4-dichlorophenyl)methylsulfanyl]-3-imidazol-1-ylpropan-1-ol |
|---|---|
| PubChem CID | 20572789 |
| Molecular Formula | C13H14Cl2N2OS |
| Molecular Weight | 317.24 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methylsulfanyl]-3-imidazol-1-ylpropan-1-ol |
| SMILES | OC(CCn1ccnc1)SCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H14Cl2N2OS/c14-11-2-1-10(12(15)7-11)8-19-13(18)3-5-17-6-4-16-9-17/h1-2,4,6-7,9,13,18H,3,5,8H2 |
| InChIKey | MAAVPFXKWMJQQL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.24 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|