C20H25Cl2NOS — CID 20572847
bicyclo[2.2.0]hexa-1(4),2,5-triene;1-[(2,4-dichlorophenyl)methylsulfanyl]-3-(diethylamino)propan-1-ol (PubChem CID 20572847) has the molecular formula C20H25Cl2NOS and a molecular weight of 398.40 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1(4),2,5-triene;1-[(2,4-dichlorophenyl)methylsulfanyl]-3-(diethylamino)propan-1-ol.
| Compound Name | bicyclo[2.2.0]hexa-1(4),2,5-triene;1-[(2,4-dichlorophenyl)methylsulfanyl]-3-(diethylamino)propan-1-ol |
|---|---|
| PubChem CID | 20572847 |
| Molecular Formula | C20H25Cl2NOS |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | bicyclo[2.2.0]hexa-1(4),2,5-triene;1-[(2,4-dichlorophenyl)methylsulfanyl]-3-(diethylamino)propan-1-ol |
| SMILES | CCN(CC)CCC(O)SCc1ccc(Cl)cc1Cl.c1cc2ccc1=2 |
| InChI | InChI=1S/C14H21Cl2NOS.C6H4/c1-3-17(4-2)8-7-14(18)19-10-11-5-6-12(15)9-13(11)16;1-2-6-4-3-5(1)6/h5-6,9,14,18H,3-4,7-8,10H2,1-2H3;1-4H |
| InChIKey | GPNYRZHXWWTUKW-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|