C20H28Cl2N2S — CID 21415180
1-[3-(2,4-dichlorophenyl)-3-octylsulfanylpropyl]imidazole (PubChem CID 21415180) has the molecular formula C20H28Cl2N2S and a molecular weight of 399.43 g/mol. Its IUPAC name is 1-[3-(2,4-dichlorophenyl)-3-octylsulfanylpropyl]imidazole.
| Compound Name | 1-[3-(2,4-dichlorophenyl)-3-octylsulfanylpropyl]imidazole |
|---|---|
| PubChem CID | 21415180 |
| Molecular Formula | C20H28Cl2N2S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 1-[3-(2,4-dichlorophenyl)-3-octylsulfanylpropyl]imidazole |
| SMILES | CCCCCCCCSC(CCn1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H28Cl2N2S/c1-2-3-4-5-6-7-14-25-20(10-12-24-13-11-23-16-24)18-9-8-17(21)15-19(18)22/h8-9,11,13,15-16,20H,2-7,10,12,14H2,1H3 |
| InChIKey | HAENITNBWONOQJ-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|