C38H46Cl4N4O4S2 — CID 56985865
bis[1-[3-(2,4-dichlorophenyl)-3-hexylsulfanylpropyl]imidazol-2-yl] oxalate (PubChem CID 56985865) has the molecular formula C38H46Cl4N4O4S2 and a molecular weight of 828.76 g/mol. Its IUPAC name is bis[1-[3-(2,4-dichlorophenyl)-3-hexylsulfanylpropyl]imidazol-2-yl] oxalate.
| Compound Name | bis[1-[3-(2,4-dichlorophenyl)-3-hexylsulfanylpropyl]imidazol-2-yl] oxalate |
|---|---|
| PubChem CID | 56985865 |
| Molecular Formula | C38H46Cl4N4O4S2 |
| Molecular Weight | 828.76 g/mol |
| Exact Mass | 826.17 |
| IUPAC Name | bis[1-[3-(2,4-dichlorophenyl)-3-hexylsulfanylpropyl]imidazol-2-yl] oxalate |
| SMILES | CCCCCCSC(CCn1ccnc1OC(=O)C(=O)Oc1nccn1CCC(SCCCCCC)c1ccc(Cl)cc1Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C38H46Cl4N4O4S2/c1-3-5-7-9-23-51-33(29-13-11-27(39)25-31(29)41)15-19-45-21-17-43-37(45)49-35(47)36(48)50-38-44-18-22-46(38)20-16-34(52-24-10-8-6-4-2)30-14-12-28(40)26-32(30)42/h11-14,17-18,21-22,25-26,33-34H,3-10,15-16,19-20,23-24H2,1-2H3 |
| InChIKey | RKDZGJPSQRQMNF-UHFFFAOYSA-N |
| XLogP | 12.09 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.76 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|