C23H18Cl4N2O4S2 — CID 88745694
(E)-4-[1-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methylsulfanylmethylsulfanyl]ethyl]imidazol-2-yl]oxy-4-oxobut-2-enoic acid (PubChem CID 88745694) has the molecular formula C23H18Cl4N2O4S2 and a molecular weight of 592.35 g/mol. Its IUPAC name is (E)-4-[1-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methylsulfanylmethylsulfanyl]ethyl]imidazol-2-yl]oxy-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[1-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methylsulfanylmethylsulfanyl]ethyl]imidazol-2-yl]oxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 88745694 |
| Molecular Formula | C23H18Cl4N2O4S2 |
| Molecular Weight | 592.35 g/mol |
| Exact Mass | 589.95 |
| IUPAC Name | (E)-4-[1-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methylsulfanylmethylsulfanyl]ethyl]imidazol-2-yl]oxy-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Oc1nccn1CC(SCSCc1ccc(Cl)cc1Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H18Cl4N2O4S2/c24-15-2-1-14(18(26)9-15)12-34-13-35-20(17-4-3-16(25)10-19(17)27)11-29-8-7-28-23(29)33-22(32)6-5-21(30)31/h1-10,20H,11-13H2,(H,30,31)/b6-5+ |
| InChIKey | JELPNCKSEXVMOI-AATRIKPKSA-N |
| XLogP | 7.41 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.35 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|