C18H14Br2Cl2N2S — CID 70637186
1-[1-bromo-2-(4-bromophenyl)-2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]imidazole (PubChem CID 70637186) has the molecular formula C18H14Br2Cl2N2S and a molecular weight of 521.11 g/mol. Its IUPAC name is 1-[1-bromo-2-(4-bromophenyl)-2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]imidazole.
| Compound Name | 1-[1-bromo-2-(4-bromophenyl)-2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]imidazole |
|---|---|
| PubChem CID | 70637186 |
| Molecular Formula | C18H14Br2Cl2N2S |
| Molecular Weight | 521.11 g/mol |
| Exact Mass | 517.86 |
| IUPAC Name | 1-[1-bromo-2-(4-bromophenyl)-2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]imidazole |
| SMILES | Clc1ccc(CSC(c2ccc(Br)cc2)C(Br)n2ccnc2)c(Cl)c1 |
| InChI | InChI=1S/C18H14Br2Cl2N2S/c19-14-4-1-12(2-5-14)17(18(20)24-8-7-23-11-24)25-10-13-3-6-15(21)9-16(13)22/h1-9,11,17-18H,10H2 |
| InChIKey | IITXTJSRBKTXEK-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.11 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|