C16H12Cl2N2S — CID 21481605
1-[2-[(2,4-dichlorophenyl)methylsulfanyl]phenyl]imidazole (PubChem CID 21481605) has the molecular formula C16H12Cl2N2S and a molecular weight of 335.26 g/mol. Its IUPAC name is 1-[2-[(2,4-dichlorophenyl)methylsulfanyl]phenyl]imidazole.
| Compound Name | 1-[2-[(2,4-dichlorophenyl)methylsulfanyl]phenyl]imidazole |
|---|---|
| PubChem CID | 21481605 |
| Molecular Formula | C16H12Cl2N2S |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 1-[2-[(2,4-dichlorophenyl)methylsulfanyl]phenyl]imidazole |
| SMILES | Clc1ccc(CSc2ccccc2-n2ccnc2)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl2N2S/c17-13-6-5-12(14(18)9-13)10-21-16-4-2-1-3-15(16)20-8-7-19-11-20/h1-9,11H,10H2 |
| InChIKey | RCJOHVBEDAYEKO-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |