C20H19Cl2N3O2 — CID 52740396
4-(2,4-dichlorophenoxy)-N-[(2-imidazol-1-ylphenyl)methyl]butanamide (PubChem CID 52740396) has the molecular formula C20H19Cl2N3O2 and a molecular weight of 404.30 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-[(2-imidazol-1-ylphenyl)methyl]butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-[(2-imidazol-1-ylphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 52740396 |
| Molecular Formula | C20H19Cl2N3O2 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-[(2-imidazol-1-ylphenyl)methyl]butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NCc1ccccc1-n1ccnc1 |
| InChI | InChI=1S/C20H19Cl2N3O2/c21-16-7-8-19(17(22)12-16)27-11-3-6-20(26)24-13-15-4-1-2-5-18(15)25-10-9-23-14-25/h1-2,4-5,7-10,12,14H,3,6,11,13H2,(H,24,26) |
| InChIKey | ZVXCATYTWATZOP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|