C17H16Cl2N4O2 — CID 39761431
4-(2,4-dichlorophenoxy)-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)butanamide (PubChem CID 39761431) has the molecular formula C17H16Cl2N4O2 and a molecular weight of 379.25 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 39761431 |
| Molecular Formula | C17H16Cl2N4O2 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NCc1nnc2ccccn12 |
| InChI | InChI=1S/C17H16Cl2N4O2/c18-12-6-7-14(13(19)10-12)25-9-3-5-17(24)20-11-16-22-21-15-4-1-2-8-23(15)16/h1-2,4,6-8,10H,3,5,9,11H2,(H,20,24) |
| InChIKey | JPYGUNVPAFKEOW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|