C19H14Cl4N2O2S2 — CID 21421028
[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanyl-[(2,4-dichlorophenyl)methoxysulfanyl]methanone (PubChem CID 21421028) has the molecular formula C19H14Cl4N2O2S2 and a molecular weight of 508.28 g/mol. Its IUPAC name is [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanyl-[(2,4-dichlorophenyl)methoxysulfanyl]methanone.
| Compound Name | [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanyl-[(2,4-dichlorophenyl)methoxysulfanyl]methanone |
|---|---|
| PubChem CID | 21421028 |
| Molecular Formula | C19H14Cl4N2O2S2 |
| Molecular Weight | 508.28 g/mol |
| Exact Mass | 505.93 |
| IUPAC Name | [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanyl-[(2,4-dichlorophenyl)methoxysulfanyl]methanone |
| SMILES | O=C(SOCc1ccc(Cl)cc1Cl)SC(Cn1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H14Cl4N2O2S2/c20-13-2-1-12(16(22)7-13)10-27-29-19(26)28-18(9-25-6-5-24-11-25)15-4-3-14(21)8-17(15)23/h1-8,11,18H,9-10H2 |
| InChIKey | IGXJDZNNUDVPNB-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.28 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|