C15H16Cl2N2O2S2 — CID 21420967
[1-(3,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanyl-propoxysulfanylmethanone (PubChem CID 21420967) has the molecular formula C15H16Cl2N2O2S2 and a molecular weight of 391.35 g/mol. Its IUPAC name is [1-(3,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanyl-propoxysulfanylmethanone.
| Compound Name | [1-(3,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanyl-propoxysulfanylmethanone |
|---|---|
| PubChem CID | 21420967 |
| Molecular Formula | C15H16Cl2N2O2S2 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | [1-(3,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanyl-propoxysulfanylmethanone |
| SMILES | CCCOSC(=O)SC(Cn1ccnc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H16Cl2N2O2S2/c1-2-7-21-23-15(20)22-14(9-19-6-5-18-10-19)11-3-4-12(16)13(17)8-11/h3-6,8,10,14H,2,7,9H2,1H3 |
| InChIKey | XZLMBALUGKRZGH-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|