C19H27ClN2S2 — CID 54114920
1-[2-[(4-chlorophenyl)methylsulfanyl]-3-hexylsulfanylpropyl]imidazole (PubChem CID 54114920) has the molecular formula C19H27ClN2S2 and a molecular weight of 383.03 g/mol. Its IUPAC name is 1-[2-[(4-chlorophenyl)methylsulfanyl]-3-hexylsulfanylpropyl]imidazole.
| Compound Name | 1-[2-[(4-chlorophenyl)methylsulfanyl]-3-hexylsulfanylpropyl]imidazole |
|---|---|
| PubChem CID | 54114920 |
| Molecular Formula | C19H27ClN2S2 |
| Molecular Weight | 383.03 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 1-[2-[(4-chlorophenyl)methylsulfanyl]-3-hexylsulfanylpropyl]imidazole |
| SMILES | CCCCCCSCC(Cn1ccnc1)SCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H27ClN2S2/c1-2-3-4-5-12-23-15-19(13-22-11-10-21-16-22)24-14-17-6-8-18(20)9-7-17/h6-11,16,19H,2-5,12-15H2,1H3 |
| InChIKey | NJRFQIZKYCZMKP-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.03 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|