C22H31ClN2S — CID 21415254
1-[2-(2-tert-butylcyclohexyl)-2-[(4-chlorophenyl)methylsulfanyl]ethyl]imidazole (PubChem CID 21415254) has the molecular formula C22H31ClN2S and a molecular weight of 391.02 g/mol. Its IUPAC name is 1-[2-(2-tert-butylcyclohexyl)-2-[(4-chlorophenyl)methylsulfanyl]ethyl]imidazole.
| Compound Name | 1-[2-(2-tert-butylcyclohexyl)-2-[(4-chlorophenyl)methylsulfanyl]ethyl]imidazole |
|---|---|
| PubChem CID | 21415254 |
| Molecular Formula | C22H31ClN2S |
| Molecular Weight | 391.02 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-[2-(2-tert-butylcyclohexyl)-2-[(4-chlorophenyl)methylsulfanyl]ethyl]imidazole |
| SMILES | CC(C)(C)C1CCCCC1C(Cn1ccnc1)SCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H31ClN2S/c1-22(2,3)20-7-5-4-6-19(20)21(14-25-13-12-24-16-25)26-15-17-8-10-18(23)11-9-17/h8-13,16,19-21H,4-7,14-15H2,1-3H3 |
| InChIKey | JCOPSEOMHMUOON-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.02 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |