C21H24N2O2S2 — CID 13320333
1-[2,2-bis[(4-methoxyphenyl)methylsulfanyl]ethyl]imidazole (PubChem CID 13320333) has the molecular formula C21H24N2O2S2 and a molecular weight of 400.57 g/mol. Its IUPAC name is 1-[2,2-bis[(4-methoxyphenyl)methylsulfanyl]ethyl]imidazole.
| Compound Name | 1-[2,2-bis[(4-methoxyphenyl)methylsulfanyl]ethyl]imidazole |
|---|---|
| PubChem CID | 13320333 |
| Molecular Formula | C21H24N2O2S2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 1-[2,2-bis[(4-methoxyphenyl)methylsulfanyl]ethyl]imidazole |
| SMILES | COc1ccc(CSC(Cn2ccnc2)SCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H24N2O2S2/c1-24-19-7-3-17(4-8-19)14-26-21(13-23-12-11-22-16-23)27-15-18-5-9-20(25-2)10-6-18/h3-12,16,21H,13-15H2,1-2H3 |
| InChIKey | FLSAEKZPHXGYLM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|