C20H20Cl2N2 — CID 70554052
1-[3-(4-chlorophenyl)-2-[(4-chlorophenyl)methyl]-2-methylpropyl]imidazole (PubChem CID 70554052) has the molecular formula C20H20Cl2N2 and a molecular weight of 359.30 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)-2-[(4-chlorophenyl)methyl]-2-methylpropyl]imidazole.
| Compound Name | 1-[3-(4-chlorophenyl)-2-[(4-chlorophenyl)methyl]-2-methylpropyl]imidazole |
|---|---|
| PubChem CID | 70554052 |
| Molecular Formula | C20H20Cl2N2 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 1-[3-(4-chlorophenyl)-2-[(4-chlorophenyl)methyl]-2-methylpropyl]imidazole |
| SMILES | CC(Cc1ccc(Cl)cc1)(Cc1ccc(Cl)cc1)Cn1ccnc1 |
| InChI | InChI=1S/C20H20Cl2N2/c1-20(14-24-11-10-23-15-24,12-16-2-6-18(21)7-3-16)13-17-4-8-19(22)9-5-17/h2-11,15H,12-14H2,1H3 |
| InChIKey | WJPWOKQVULKKHC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |