C22H25ClN2S — CID 22762829
1-[2-[(4-chlorophenyl)methylsulfanyl]-2-methyl-4-(4-methylphenyl)butyl]imidazole (PubChem CID 22762829) has the molecular formula C22H25ClN2S and a molecular weight of 384.98 g/mol. Its IUPAC name is 1-[2-[(4-chlorophenyl)methylsulfanyl]-2-methyl-4-(4-methylphenyl)butyl]imidazole.
| Compound Name | 1-[2-[(4-chlorophenyl)methylsulfanyl]-2-methyl-4-(4-methylphenyl)butyl]imidazole |
|---|---|
| PubChem CID | 22762829 |
| Molecular Formula | C22H25ClN2S |
| Molecular Weight | 384.98 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 1-[2-[(4-chlorophenyl)methylsulfanyl]-2-methyl-4-(4-methylphenyl)butyl]imidazole |
| SMILES | Cc1ccc(CCC(C)(Cn2ccnc2)SCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H25ClN2S/c1-18-3-5-19(6-4-18)11-12-22(2,16-25-14-13-24-17-25)26-15-20-7-9-21(23)10-8-20/h3-10,13-14,17H,11-12,15-16H2,1-2H3 |
| InChIKey | IEPXZNLQWNFASZ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.98 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |