C24H29FN2S — CID 22762948
1-[2-(4-tert-butylphenyl)sulfanyl-4-(4-fluorophenyl)-2-methylbutyl]imidazole (PubChem CID 22762948) has the molecular formula C24H29FN2S and a molecular weight of 396.58 g/mol. Its IUPAC name is 1-[2-(4-tert-butylphenyl)sulfanyl-4-(4-fluorophenyl)-2-methylbutyl]imidazole.
| Compound Name | 1-[2-(4-tert-butylphenyl)sulfanyl-4-(4-fluorophenyl)-2-methylbutyl]imidazole |
|---|---|
| PubChem CID | 22762948 |
| Molecular Formula | C24H29FN2S |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 1-[2-(4-tert-butylphenyl)sulfanyl-4-(4-fluorophenyl)-2-methylbutyl]imidazole |
| SMILES | CC(CCc1ccc(F)cc1)(Cn1ccnc1)Sc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H29FN2S/c1-23(2,3)20-7-11-22(12-8-20)28-24(4,17-27-16-15-26-18-27)14-13-19-5-9-21(25)10-6-19/h5-12,15-16,18H,13-14,17H2,1-4H3 |
| InChIKey | JLIAJZQGRVJKFR-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |