C22H25FN2OS — CID 22762834
1-[2-(2-ethoxyphenyl)sulfanyl-4-(4-fluorophenyl)-2-methylbutyl]imidazole (PubChem CID 22762834) has the molecular formula C22H25FN2OS and a molecular weight of 384.52 g/mol. Its IUPAC name is 1-[2-(2-ethoxyphenyl)sulfanyl-4-(4-fluorophenyl)-2-methylbutyl]imidazole.
| Compound Name | 1-[2-(2-ethoxyphenyl)sulfanyl-4-(4-fluorophenyl)-2-methylbutyl]imidazole |
|---|---|
| PubChem CID | 22762834 |
| Molecular Formula | C22H25FN2OS |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 1-[2-(2-ethoxyphenyl)sulfanyl-4-(4-fluorophenyl)-2-methylbutyl]imidazole |
| SMILES | CCOc1ccccc1SC(C)(CCc1ccc(F)cc1)Cn1ccnc1 |
| InChI | InChI=1S/C22H25FN2OS/c1-3-26-20-6-4-5-7-21(20)27-22(2,16-25-15-14-24-17-25)13-12-18-8-10-19(23)11-9-18/h4-11,14-15,17H,3,12-13,16H2,1-2H3 |
| InChIKey | RMFCNWVZVHRGBX-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |