C21H22Cl2N2S — CID 22762943
1-[5-(4-chlorophenyl)-3-(2-chlorophenyl)sulfanyl-3-methylpentyl]imidazole (PubChem CID 22762943) has the molecular formula C21H22Cl2N2S and a molecular weight of 405.39 g/mol. Its IUPAC name is 1-[5-(4-chlorophenyl)-3-(2-chlorophenyl)sulfanyl-3-methylpentyl]imidazole.
| Compound Name | 1-[5-(4-chlorophenyl)-3-(2-chlorophenyl)sulfanyl-3-methylpentyl]imidazole |
|---|---|
| PubChem CID | 22762943 |
| Molecular Formula | C21H22Cl2N2S |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 1-[5-(4-chlorophenyl)-3-(2-chlorophenyl)sulfanyl-3-methylpentyl]imidazole |
| SMILES | CC(CCc1ccc(Cl)cc1)(CCn1ccnc1)Sc1ccccc1Cl |
| InChI | InChI=1S/C21H22Cl2N2S/c1-21(12-14-25-15-13-24-16-25,26-20-5-3-2-4-19(20)23)11-10-17-6-8-18(22)9-7-17/h2-9,13,15-16H,10-12,14H2,1H3 |
| InChIKey | VSNOCFLTCVFTER-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |