C16H21ClN2O — CID 10613637
3-[(4-chlorophenyl)methyl]-1-imidazol-1-yl-4-methylpentan-3-ol (PubChem CID 10613637) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-1-imidazol-1-yl-4-methylpentan-3-ol.
| Compound Name | 3-[(4-chlorophenyl)methyl]-1-imidazol-1-yl-4-methylpentan-3-ol |
|---|---|
| PubChem CID | 10613637 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-1-imidazol-1-yl-4-methylpentan-3-ol |
| SMILES | CC(C)C(O)(CCn1ccnc1)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H21ClN2O/c1-13(2)16(20,7-9-19-10-8-18-12-19)11-14-3-5-15(17)6-4-14/h3-6,8,10,12-13,20H,7,9,11H2,1-2H3 |
| InChIKey | STVSFEBDQUSEBQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |