C15H19ClN2O — CID 22762962
3-(4-chlorophenyl)-6-imidazol-1-ylhexan-3-ol (PubChem CID 22762962) has the molecular formula C15H19ClN2O and a molecular weight of 278.78 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-6-imidazol-1-ylhexan-3-ol.
| Compound Name | 3-(4-chlorophenyl)-6-imidazol-1-ylhexan-3-ol |
|---|---|
| PubChem CID | 22762962 |
| Molecular Formula | C15H19ClN2O |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 3-(4-chlorophenyl)-6-imidazol-1-ylhexan-3-ol |
| SMILES | CCC(O)(CCCn1ccnc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H19ClN2O/c1-2-15(19,13-4-6-14(16)7-5-13)8-3-10-18-11-9-17-12-18/h4-7,9,11-12,19H,2-3,8,10H2,1H3 |
| InChIKey | APPQXTRQJKGHOK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |