C17H13Cl3N2O — CID 20519458
1-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-2-imidazol-1-ylethanol (PubChem CID 20519458) has the molecular formula C17H13Cl3N2O and a molecular weight of 367.66 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-2-imidazol-1-ylethanol.
| Compound Name | 1-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-2-imidazol-1-ylethanol |
|---|---|
| PubChem CID | 20519458 |
| Molecular Formula | C17H13Cl3N2O |
| Molecular Weight | 367.66 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 1-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-2-imidazol-1-ylethanol |
| SMILES | OC(Cn1ccnc1)(c1ccc(Cl)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H13Cl3N2O/c18-13-3-1-12(2-4-13)17(23,10-22-8-7-21-11-22)15-6-5-14(19)9-16(15)20/h1-9,11,23H,10H2 |
| InChIKey | JWNCWCBYPSOHNH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.66 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |