C18H15Cl2FN2O — CID 20519440
1-(2,4-dichlorophenyl)-2-(4-fluorophenyl)-3-imidazol-1-ylpropan-2-ol (PubChem CID 20519440) has the molecular formula C18H15Cl2FN2O and a molecular weight of 365.24 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-(4-fluorophenyl)-3-imidazol-1-ylpropan-2-ol.
| Compound Name | 1-(2,4-dichlorophenyl)-2-(4-fluorophenyl)-3-imidazol-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 20519440 |
| Molecular Formula | C18H15Cl2FN2O |
| Molecular Weight | 365.24 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-(4-fluorophenyl)-3-imidazol-1-ylpropan-2-ol |
| SMILES | OC(Cc1ccc(Cl)cc1Cl)(Cn1ccnc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H15Cl2FN2O/c19-15-4-1-13(17(20)9-15)10-18(24,11-23-8-7-22-12-23)14-2-5-16(21)6-3-14/h1-9,12,24H,10-11H2 |
| InChIKey | TXNLAAGYGYNDEA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.24 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |