C15H16Cl2N2O2 — CID 3068282
2-(2,4-dichlorophenyl)-1-imidazol-1-yl-3-prop-2-enoxypropan-2-ol (PubChem CID 3068282) has the molecular formula C15H16Cl2N2O2 and a molecular weight of 327.21 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-imidazol-1-yl-3-prop-2-enoxypropan-2-ol.
| Compound Name | 2-(2,4-dichlorophenyl)-1-imidazol-1-yl-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 3068282 |
| Molecular Formula | C15H16Cl2N2O2 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-imidazol-1-yl-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOCC(O)(Cn1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H16Cl2N2O2/c1-2-7-21-10-15(20,9-19-6-5-18-11-19)13-4-3-12(16)8-14(13)17/h2-6,8,11,20H,1,7,9-10H2 |
| InChIKey | KNWOUSMMYJNHDA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|