C16H21Cl3N2OS — CID 70472519
(2S)-1-butylsulfanyl-2-(2,4-dichlorophenyl)-3-imidazol-1-ylpropan-2-ol;hydrochloride (PubChem CID 70472519) has the molecular formula C16H21Cl3N2OS and a molecular weight of 395.78 g/mol. Its IUPAC name is (2S)-1-butylsulfanyl-2-(2,4-dichlorophenyl)-3-imidazol-1-ylpropan-2-ol;hydrochloride.
| Compound Name | (2S)-1-butylsulfanyl-2-(2,4-dichlorophenyl)-3-imidazol-1-ylpropan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 70472519 |
| Molecular Formula | C16H21Cl3N2OS |
| Molecular Weight | 395.78 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | (2S)-1-butylsulfanyl-2-(2,4-dichlorophenyl)-3-imidazol-1-ylpropan-2-ol;hydrochloride |
| SMILES | CCCCSC[C@@](O)(Cn1ccnc1)c1ccc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C16H20Cl2N2OS.ClH/c1-2-3-8-22-11-16(21,10-20-7-6-19-12-20)14-5-4-13(17)9-15(14)18;/h4-7,9,12,21H,2-3,8,10-11H2,1H3;1H/t16-;/m0./s1 |
| InChIKey | GYJPRBFOYUKMDU-NTISSMGPSA-N |
| XLogP | 5.03 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.78 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|