C16H20Cl2N2S — CID 20512684
1-[2-(2,4-dichlorophenyl)sulfanyl-2-methylhexyl]imidazole (PubChem CID 20512684) has the molecular formula C16H20Cl2N2S and a molecular weight of 343.32 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)sulfanyl-2-methylhexyl]imidazole.
| Compound Name | 1-[2-(2,4-dichlorophenyl)sulfanyl-2-methylhexyl]imidazole |
|---|---|
| PubChem CID | 20512684 |
| Molecular Formula | C16H20Cl2N2S |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)sulfanyl-2-methylhexyl]imidazole |
| SMILES | CCCCC(C)(Cn1ccnc1)Sc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H20Cl2N2S/c1-3-4-7-16(2,11-20-9-8-19-12-20)21-15-6-5-13(17)10-14(15)18/h5-6,8-10,12H,3-4,7,11H2,1-2H3 |
| InChIKey | GLPCNGCHWPPNKW-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |