C18H24Cl2N2OS — CID 54487448
1-[2-(3,4-dichlorophenyl)sulfanyl-2-hexoxypropyl]imidazole (PubChem CID 54487448) has the molecular formula C18H24Cl2N2OS and a molecular weight of 387.38 g/mol. Its IUPAC name is 1-[2-(3,4-dichlorophenyl)sulfanyl-2-hexoxypropyl]imidazole.
| Compound Name | 1-[2-(3,4-dichlorophenyl)sulfanyl-2-hexoxypropyl]imidazole |
|---|---|
| PubChem CID | 54487448 |
| Molecular Formula | C18H24Cl2N2OS |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 1-[2-(3,4-dichlorophenyl)sulfanyl-2-hexoxypropyl]imidazole |
| SMILES | CCCCCCOC(C)(Cn1ccnc1)Sc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H24Cl2N2OS/c1-3-4-5-6-11-23-18(2,13-22-10-9-21-14-22)24-15-7-8-16(19)17(20)12-15/h7-10,12,14H,3-6,11,13H2,1-2H3 |
| InChIKey | XTHVKPCYZHFWJS-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|