C19H27ClN2OS — CID 24839002
2-(2-chlorophenyl)-1-heptylsulfanyl-3-imidazol-1-ylpropan-2-ol (PubChem CID 24839002) has the molecular formula C19H27ClN2OS and a molecular weight of 366.96 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-heptylsulfanyl-3-imidazol-1-ylpropan-2-ol.
| Compound Name | 2-(2-chlorophenyl)-1-heptylsulfanyl-3-imidazol-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 24839002 |
| Molecular Formula | C19H27ClN2OS |
| Molecular Weight | 366.96 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-(2-chlorophenyl)-1-heptylsulfanyl-3-imidazol-1-ylpropan-2-ol |
| SMILES | CCCCCCCSCC(O)(Cn1ccnc1)c1ccccc1Cl |
| InChI | InChI=1S/C19H27ClN2OS/c1-2-3-4-5-8-13-24-15-19(23,14-22-12-11-21-16-22)17-9-6-7-10-18(17)20/h6-7,9-12,16,23H,2-5,8,13-15H2,1H3 |
| InChIKey | AZUYVBDRBXNVSA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.96 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|