C15H16Cl2N2OS — CID 70417205
2-(2,3-dichlorophenyl)-1-imidazol-1-yl-3-prop-2-enylsulfanylpropan-2-ol (PubChem CID 70417205) has the molecular formula C15H16Cl2N2OS and a molecular weight of 343.28 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-1-imidazol-1-yl-3-prop-2-enylsulfanylpropan-2-ol.
| Compound Name | 2-(2,3-dichlorophenyl)-1-imidazol-1-yl-3-prop-2-enylsulfanylpropan-2-ol |
|---|---|
| PubChem CID | 70417205 |
| Molecular Formula | C15H16Cl2N2OS |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-1-imidazol-1-yl-3-prop-2-enylsulfanylpropan-2-ol |
| SMILES | C=CCSCC(O)(Cn1ccnc1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H16Cl2N2OS/c1-2-8-21-10-15(20,9-19-7-6-18-11-19)12-4-3-5-13(16)14(12)17/h2-7,11,20H,1,8-10H2 |
| InChIKey | DGFCFGSERYFNBE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|