C14H15FN2O — CID 12771346
2-(4-fluorophenyl)-1-imidazol-1-ylpent-4-en-2-ol (PubChem CID 12771346) has the molecular formula C14H15FN2O and a molecular weight of 246.29 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-imidazol-1-ylpent-4-en-2-ol.
| Compound Name | 2-(4-fluorophenyl)-1-imidazol-1-ylpent-4-en-2-ol |
|---|---|
| PubChem CID | 12771346 |
| Molecular Formula | C14H15FN2O |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 2-(4-fluorophenyl)-1-imidazol-1-ylpent-4-en-2-ol |
| SMILES | C=CCC(O)(Cn1ccnc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H15FN2O/c1-2-7-14(18,10-17-9-8-16-11-17)12-3-5-13(15)6-4-12/h2-6,8-9,11,18H,1,7,10H2 |
| InChIKey | QPPOLSSZUZASKN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|