C14H15Cl3N2O — CID 70569120
2-(2,4-dichlorophenyl)-1-imidazol-1-ylpent-4-en-2-ol;hydrochloride (PubChem CID 70569120) has the molecular formula C14H15Cl3N2O and a molecular weight of 333.65 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-imidazol-1-ylpent-4-en-2-ol;hydrochloride.
| Compound Name | 2-(2,4-dichlorophenyl)-1-imidazol-1-ylpent-4-en-2-ol;hydrochloride |
|---|---|
| PubChem CID | 70569120 |
| Molecular Formula | C14H15Cl3N2O |
| Molecular Weight | 333.65 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-imidazol-1-ylpent-4-en-2-ol;hydrochloride |
| SMILES | C=CCC(O)(Cn1ccnc1)c1ccc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C14H14Cl2N2O.ClH/c1-2-5-14(19,9-18-7-6-17-10-18)12-4-3-11(15)8-13(12)16;/h2-4,6-8,10,19H,1,5,9H2;1H |
| InChIKey | NGXOLJKACFETFI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.65 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|