C16H20Cl2N4O — CID 70480605
2-(2,4-dichlorophenyl)-1-imidazol-1-yl-3-piperazin-1-ylpropan-2-ol (PubChem CID 70480605) has the molecular formula C16H20Cl2N4O and a molecular weight of 355.27 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-imidazol-1-yl-3-piperazin-1-ylpropan-2-ol.
| Compound Name | 2-(2,4-dichlorophenyl)-1-imidazol-1-yl-3-piperazin-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 70480605 |
| Molecular Formula | C16H20Cl2N4O |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-imidazol-1-yl-3-piperazin-1-ylpropan-2-ol |
| SMILES | OC(CN1CCNCC1)(Cn1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H20Cl2N4O/c17-13-1-2-14(15(18)9-13)16(23,11-22-8-5-20-12-22)10-21-6-3-19-4-7-21/h1-2,5,8-9,12,19,23H,3-4,6-7,10-11H2 |
| InChIKey | XIWMZCBKPJVLFX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |