C15H17Cl3N2 — CID 19759744
1-[2-chloro-2-(2,4-dichlorophenyl)hexyl]imidazole (PubChem CID 19759744) has the molecular formula C15H17Cl3N2 and a molecular weight of 331.67 g/mol. Its IUPAC name is 1-[2-chloro-2-(2,4-dichlorophenyl)hexyl]imidazole.
| Compound Name | 1-[2-chloro-2-(2,4-dichlorophenyl)hexyl]imidazole |
|---|---|
| PubChem CID | 19759744 |
| Molecular Formula | C15H17Cl3N2 |
| Molecular Weight | 331.67 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 1-[2-chloro-2-(2,4-dichlorophenyl)hexyl]imidazole |
| SMILES | CCCCC(Cl)(Cn1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H17Cl3N2/c1-2-3-6-15(18,10-20-8-7-19-11-20)13-5-4-12(16)9-14(13)17/h4-5,7-9,11H,2-3,6,10H2,1H3 |
| InChIKey | DMAKTAAYKWXBCJ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.67 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|